C28H26N2O5 — CID 10552313
benzyl (2S)-2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanoate (PubChem CID 10552313) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is benzyl (2S)-2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanoate.
| Compound Name | benzyl (2S)-2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanoate |
|---|---|
| PubChem CID | 10552313 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | benzyl (2S)-2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxypropanoate |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(O[C@@H](C)C(=O)OCc3ccccc3)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2O5/c1-18-24(26(31)27(29)32)25-22(30(18)16-20-10-5-3-6-11-20)14-9-15-23(25)35-19(2)28(33)34-17-21-12-7-4-8-13-21/h3-15,19H,16-17H2,1-2H3,(H2,29,32)/t19-/m0/s1 |
| InChIKey | CXYOOOYYIAQEGI-IBGZPJMESA-N |
| XLogP | 4.18 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|