C22H22N2O4 — CID 10833504
methyl 3-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)propanoate (PubChem CID 10833504) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 3-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)propanoate.
| Compound Name | methyl 3-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)propanoate |
|---|---|
| PubChem CID | 10833504 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 3-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)propanoate |
| SMILES | COC(=O)CCc1cccc2c1c(C(=O)C(N)=O)c(C)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H22N2O4/c1-14-19(21(26)22(23)27)20-16(11-12-18(25)28-2)9-6-10-17(20)24(14)13-15-7-4-3-5-8-15/h3-10H,11-13H2,1-2H3,(H2,23,27) |
| InChIKey | SAKOACDLUGJTQN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|