C24H25N3O8S — CID 58017198
4-[[2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetyl]sulfamoyl]butanoic acid (PubChem CID 58017198) has the molecular formula C24H25N3O8S and a molecular weight of 515.54 g/mol. Its IUPAC name is 4-[[2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 58017198 |
| Molecular Formula | C24H25N3O8S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 4-[[2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxyacetyl]sulfamoyl]butanoic acid |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)NS(=O)(=O)CCCC(=O)O)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H25N3O8S/c1-15-21(23(31)24(25)32)22-17(27(15)13-16-7-3-2-4-8-16)9-5-10-18(22)35-14-19(28)26-36(33,34)12-6-11-20(29)30/h2-5,7-10H,6,11-14H2,1H3,(H2,25,32)(H,26,28)(H,29,30) |
| InChIKey | CDSPZUBWRACMMQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 174.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|