C30H31N3O6S — CID 24951033
2-[1-benzyl-4-[2-[(2-methylphenyl)sulfonylamino]-2-oxoethoxy]-2-(2-methylpropyl)indol-3-yl]-2-oxoacetamide (PubChem CID 24951033) has the molecular formula C30H31N3O6S and a molecular weight of 561.66 g/mol. Its IUPAC name is 2-[1-benzyl-4-[2-[(2-methylphenyl)sulfonylamino]-2-oxoethoxy]-2-(2-methylpropyl)indol-3-yl]-2-oxoacetamide.
| Compound Name | 2-[1-benzyl-4-[2-[(2-methylphenyl)sulfonylamino]-2-oxoethoxy]-2-(2-methylpropyl)indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 24951033 |
| Molecular Formula | C30H31N3O6S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 2-[1-benzyl-4-[2-[(2-methylphenyl)sulfonylamino]-2-oxoethoxy]-2-(2-methylpropyl)indol-3-yl]-2-oxoacetamide |
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)COc1cccc2c1c(C(=O)C(N)=O)c(CC(C)C)n2Cc1ccccc1 |
| InChI | InChI=1S/C30H31N3O6S/c1-19(2)16-23-28(29(35)30(31)36)27-22(33(23)17-21-11-5-4-6-12-21)13-9-14-24(27)39-18-26(34)32-40(37,38)25-15-8-7-10-20(25)3/h4-15,19H,16-18H2,1-3H3,(H2,31,36)(H,32,34) |
| InChIKey | ALJJMKCAOSCZMO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|