C28H33N3O6 — CID 18008135
methyl 2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]-3-methylpentanoate (PubChem CID 18008135) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is methyl 2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 18008135 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | methyl 2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]-3-methylpentanoate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)NC(C(=O)OC)C(C)CC)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C28H33N3O6/c1-5-17(3)25(28(35)36-4)30-22(32)16-37-21-14-10-13-20-23(21)24(26(33)27(29)34)19(6-2)31(20)15-18-11-8-7-9-12-18/h7-14,17,25H,5-6,15-16H2,1-4H3,(H2,29,34)(H,30,32) |
| InChIKey | UZNNXXRDYPBOMG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|