C27H29N3O8 — CID 59101573
dimethyl (2S)-2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]butanedioate (PubChem CID 59101573) has the molecular formula C27H29N3O8 and a molecular weight of 523.54 g/mol. Its IUPAC name is dimethyl (2S)-2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]butanedioate |
|---|---|
| PubChem CID | 59101573 |
| Molecular Formula | C27H29N3O8 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | dimethyl (2S)-2-[[2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetyl]amino]butanedioate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)N[C@@H](CC(=O)OC)C(=O)OC)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C27H29N3O8/c1-4-18-24(25(33)26(28)34)23-19(30(18)14-16-9-6-5-7-10-16)11-8-12-20(23)38-15-21(31)29-17(27(35)37-3)13-22(32)36-2/h5-12,17H,4,13-15H2,1-3H3,(H2,28,34)(H,29,31)/t17-/m0/s1 |
| InChIKey | NOZPYBDYEHKHEQ-KRWDZBQOSA-N |
| XLogP | 1.52 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|