C20H22N2O8S — CID 10114815
dimethyl (2R)-2-[[2-[(2-ethyl-3-oxamoyl-1-benzothiophen-4-yl)oxy]acetyl]amino]butanedioate (PubChem CID 10114815) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is dimethyl (2R)-2-[[2-[(2-ethyl-3-oxamoyl-1-benzothiophen-4-yl)oxy]acetyl]amino]butanedioate.
| Compound Name | dimethyl (2R)-2-[[2-[(2-ethyl-3-oxamoyl-1-benzothiophen-4-yl)oxy]acetyl]amino]butanedioate |
|---|---|
| PubChem CID | 10114815 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | dimethyl (2R)-2-[[2-[(2-ethyl-3-oxamoyl-1-benzothiophen-4-yl)oxy]acetyl]amino]butanedioate |
| SMILES | CCc1sc2cccc(OCC(=O)N[C@H](CC(=O)OC)C(=O)OC)c2c1C(=O)C(N)=O |
| InChI | InChI=1S/C20H22N2O8S/c1-4-12-17(18(25)19(21)26)16-11(6-5-7-13(16)31-12)30-9-14(23)22-10(20(27)29-3)8-15(24)28-2/h5-7,10H,4,8-9H2,1-3H3,(H2,21,26)(H,22,23)/t10-/m1/s1 |
| InChIKey | ZYXJCTSAUWFDHA-SNVBAGLBSA-N |
| XLogP | 0.73 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|