C22H23NO4S — CID 7860210
ethyl 5-ethyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 7860210) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl 5-ethyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7860210 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl 5-ethyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COc2cccc3ccccc23)sc(CC)c1C |
| InChI | InChI=1S/C22H23NO4S/c1-4-18-14(3)20(22(25)26-5-2)21(28-18)23-19(24)13-27-17-12-8-10-15-9-6-7-11-16(15)17/h6-12H,4-5,13H2,1-3H3,(H,23,24) |
| InChIKey | POMWQWSGCJSGHQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |