C20H24N2O5S — CID 7698351
ethyl 2-[[2-(3-acetamidophenoxy)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate (PubChem CID 7698351) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is ethyl 2-[[2-(3-acetamidophenoxy)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-acetamidophenoxy)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7698351 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | ethyl 2-[[2-(3-acetamidophenoxy)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COc2cccc(NC(C)=O)c2)sc(CC)c1C |
| InChI | InChI=1S/C20H24N2O5S/c1-5-16-12(3)18(20(25)26-6-2)19(28-16)22-17(24)11-27-15-9-7-8-14(10-15)21-13(4)23/h7-10H,5-6,11H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | QWAOCINBDVRNIC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |