C30H28N2O4 — CID 143459558
2-[4-(2-cyclobutylidene-2-hydroxyethoxy)-2-methyl-1-[(4-phenylphenyl)methyl]indol-3-yl]-2-oxoacetamide (PubChem CID 143459558) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 2-[4-(2-cyclobutylidene-2-hydroxyethoxy)-2-methyl-1-[(4-phenylphenyl)methyl]indol-3-yl]-2-oxoacetamide.
| Compound Name | 2-[4-(2-cyclobutylidene-2-hydroxyethoxy)-2-methyl-1-[(4-phenylphenyl)methyl]indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 143459558 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-[4-(2-cyclobutylidene-2-hydroxyethoxy)-2-methyl-1-[(4-phenylphenyl)methyl]indol-3-yl]-2-oxoacetamide |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(O)=C3CCC3)cccc2n1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O4/c1-19-27(29(34)30(31)35)28-24(11-6-12-26(28)36-18-25(33)23-9-5-10-23)32(19)17-20-13-15-22(16-14-20)21-7-3-2-4-8-21/h2-4,6-8,11-16,33H,5,9-10,17-18H2,1H3,(H2,31,35) |
| InChIKey | WQRHOLFFZQZTCN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|