C21H19ClN2O5 — CID 10811760
methyl 2-[1-[(2-chlorophenyl)methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate (PubChem CID 10811760) has the molecular formula C21H19ClN2O5 and a molecular weight of 414.85 g/mol. Its IUPAC name is methyl 2-[1-[(2-chlorophenyl)methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate.
| Compound Name | methyl 2-[1-[(2-chlorophenyl)methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 10811760 |
| Molecular Formula | C21H19ClN2O5 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | methyl 2-[1-[(2-chlorophenyl)methyl]-2-methyl-3-oxamoylindol-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cccc2c1c(C(=O)C(N)=O)c(C)n2Cc1ccccc1Cl |
| InChI | InChI=1S/C21H19ClN2O5/c1-12-18(20(26)21(23)27)19-15(8-5-9-16(19)29-11-17(25)28-2)24(12)10-13-6-3-4-7-14(13)22/h3-9H,10-11H2,1-2H3,(H2,23,27) |
| InChIKey | AWHALTFUYDANFT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|