C23H25N3O5 — CID 91192628
methyl 2-[1-benzyl-3-[(E)-C-carbamoyl-N-methoxycarbonimidoyl]-2-methylindol-4-yl]oxypropanoate (PubChem CID 91192628) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 2-[1-benzyl-3-[(E)-C-carbamoyl-N-methoxycarbonimidoyl]-2-methylindol-4-yl]oxypropanoate.
| Compound Name | methyl 2-[1-benzyl-3-[(E)-C-carbamoyl-N-methoxycarbonimidoyl]-2-methylindol-4-yl]oxypropanoate |
|---|---|
| PubChem CID | 91192628 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | methyl 2-[1-benzyl-3-[(E)-C-carbamoyl-N-methoxycarbonimidoyl]-2-methylindol-4-yl]oxypropanoate |
| SMILES | CO/N=C(/C(N)=O)c1c(C)n(Cc2ccccc2)c2cccc(OC(C)C(=O)OC)c12 |
| InChI | InChI=1S/C23H25N3O5/c1-14-19(21(22(24)27)25-30-4)20-17(26(14)13-16-9-6-5-7-10-16)11-8-12-18(20)31-15(2)23(28)29-3/h5-12,15H,13H2,1-4H3,(H2,24,27)/b25-21+ |
| InChIKey | PULZXXDNJRQTER-NJNXFGOHSA-N |
| XLogP | 2.77 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|