C23H27NO3 — CID 143459761
2-(1-benzyl-2,3-dimethylindol-4-yl)oxy-4-methylpentanoic acid (PubChem CID 143459761) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 2-(1-benzyl-2,3-dimethylindol-4-yl)oxy-4-methylpentanoic acid.
| Compound Name | 2-(1-benzyl-2,3-dimethylindol-4-yl)oxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 143459761 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-(1-benzyl-2,3-dimethylindol-4-yl)oxy-4-methylpentanoic acid |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2cccc(OC(CC(C)C)C(=O)O)c12 |
| InChI | InChI=1S/C23H27NO3/c1-15(2)13-21(23(25)26)27-20-12-8-11-19-22(20)16(3)17(4)24(19)14-18-9-6-5-7-10-18/h5-12,15,21H,13-14H2,1-4H3,(H,25,26) |
| InChIKey | ZQCIPDCWMSDDEL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |