C30H23FN2O5 — CID 139993761
2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[f]indol-4-yl]oxyacetic acid (PubChem CID 139993761) has the molecular formula C30H23FN2O5 and a molecular weight of 510.52 g/mol. Its IUPAC name is 2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[f]indol-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[f]indol-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 139993761 |
| Molecular Formula | C30H23FN2O5 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[f]indol-4-yl]oxyacetic acid |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)O)c3ccccc3cc2n1Cc1cccc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C30H23FN2O5/c1-17-26(28(36)30(32)37)27-24(14-21-6-2-3-8-23(21)29(27)38-16-25(34)35)33(17)15-18-5-4-7-20(13-18)19-9-11-22(31)12-10-19/h2-14H,15-16H2,1H3,(H2,32,37)(H,34,35) |
| InChIKey | IQMNUBBMTYCMTN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|