C26H32N2O5 — CID 90817643
2-(1-benzyl-2,5,6,7-tetramethyl-3-oxamoylindol-4-yl)oxypropanoic acid;ethane (PubChem CID 90817643) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-(1-benzyl-2,5,6,7-tetramethyl-3-oxamoylindol-4-yl)oxypropanoic acid;ethane.
| Compound Name | 2-(1-benzyl-2,5,6,7-tetramethyl-3-oxamoylindol-4-yl)oxypropanoic acid;ethane |
|---|---|
| PubChem CID | 90817643 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-(1-benzyl-2,5,6,7-tetramethyl-3-oxamoylindol-4-yl)oxypropanoic acid;ethane |
| SMILES | CC.Cc1c(C)c(C)c2c(c1OC(C)C(=O)O)c(C(=O)C(N)=O)c(C)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H26N2O5.C2H6/c1-12-13(2)20-19(22(14(12)3)31-16(5)24(29)30)18(21(27)23(25)28)15(4)26(20)11-17-9-7-6-8-10-17;1-2/h6-10,16H,11H2,1-5H3,(H2,25,28)(H,29,30);1-2H3 |
| InChIKey | SLVKIXZBABPCFX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|