C30H25N3O4S — CID 142148590
2-[1-benzyl-2-methyl-4-[2-oxo-2-(phenylsulfanylamino)ethoxy]benzo[f]indol-3-yl]-2-oxoacetamide (PubChem CID 142148590) has the molecular formula C30H25N3O4S and a molecular weight of 523.61 g/mol. Its IUPAC name is 2-[1-benzyl-2-methyl-4-[2-oxo-2-(phenylsulfanylamino)ethoxy]benzo[f]indol-3-yl]-2-oxoacetamide.
| Compound Name | 2-[1-benzyl-2-methyl-4-[2-oxo-2-(phenylsulfanylamino)ethoxy]benzo[f]indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 142148590 |
| Molecular Formula | C30H25N3O4S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-[1-benzyl-2-methyl-4-[2-oxo-2-(phenylsulfanylamino)ethoxy]benzo[f]indol-3-yl]-2-oxoacetamide |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)NSc3ccccc3)c3ccccc3cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C30H25N3O4S/c1-19-26(28(35)30(31)36)27-24(33(19)17-20-10-4-2-5-11-20)16-21-12-8-9-15-23(21)29(27)37-18-25(34)32-38-22-13-6-3-7-14-22/h2-16H,17-18H2,1H3,(H2,31,36)(H,32,34) |
| InChIKey | HVLXTVKJUPQXAV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|