C31H25FN2O5 — CID 10208405
methyl 2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[g]indol-4-yl]oxyacetate (PubChem CID 10208405) has the molecular formula C31H25FN2O5 and a molecular weight of 524.55 g/mol. Its IUPAC name is methyl 2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[g]indol-4-yl]oxyacetate.
| Compound Name | methyl 2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[g]indol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 10208405 |
| Molecular Formula | C31H25FN2O5 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | methyl 2-[1-[[3-(4-fluorophenyl)phenyl]methyl]-2-methyl-3-oxamoylbenzo[g]indol-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cc2ccccc2c2c1c(C(=O)C(N)=O)c(C)n2Cc1cccc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C31H25FN2O5/c1-18-27(30(36)31(33)37)28-25(39-17-26(35)38-2)15-22-7-3-4-9-24(22)29(28)34(18)16-19-6-5-8-21(14-19)20-10-12-23(32)13-11-20/h3-15H,16-17H2,1-2H3,(H2,33,37) |
| InChIKey | NAMSDGVZMOURBQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|