C24H25N3O5 — CID 10788995
3-[acetyl-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)amino]propanoic acid (PubChem CID 10788995) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[acetyl-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)amino]propanoic acid.
| Compound Name | 3-[acetyl-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 10788995 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-[acetyl-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)amino]propanoic acid |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(N(CCC(=O)O)C(C)=O)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H25N3O5/c1-3-17-22(23(31)24(25)32)21-18(26(15(2)28)13-12-20(29)30)10-7-11-19(21)27(17)14-16-8-5-4-6-9-16/h4-11H,3,12-14H2,1-2H3,(H2,25,32)(H,29,30) |
| InChIKey | JNFRMYNRTOMQRI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|