C27H30ClN3O6 — CID 91259942
2-morpholin-4-ylethyl 2-[1-[(3-chlorophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate (PubChem CID 91259942) has the molecular formula C27H30ClN3O6 and a molecular weight of 528.01 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-[1-[(3-chlorophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate.
| Compound Name | 2-morpholin-4-ylethyl 2-[1-[(3-chlorophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 91259942 |
| Molecular Formula | C27H30ClN3O6 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-[1-[(3-chlorophenyl)methyl]-2-ethyl-3-oxamoylindol-4-yl]oxyacetate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)OCCN3CCOCC3)cccc2n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H30ClN3O6/c1-2-20-25(26(33)27(29)34)24-21(31(20)16-18-5-3-6-19(28)15-18)7-4-8-22(24)37-17-23(32)36-14-11-30-9-12-35-13-10-30/h3-8,15H,2,9-14,16-17H2,1H3,(H2,29,34) |
| InChIKey | LKWRBQMVTOYCDM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|