C29H36N2O6 — CID 142093227
2-morpholin-4-ylethyl 2-[2-[(E)-1-amino-4-ethyl-1,2-dioxo-6-phenylhex-3-en-3-yl]-3-methylphenoxy]acetate (PubChem CID 142093227) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-[2-[(E)-1-amino-4-ethyl-1,2-dioxo-6-phenylhex-3-en-3-yl]-3-methylphenoxy]acetate.
| Compound Name | 2-morpholin-4-ylethyl 2-[2-[(E)-1-amino-4-ethyl-1,2-dioxo-6-phenylhex-3-en-3-yl]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 142093227 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-[2-[(E)-1-amino-4-ethyl-1,2-dioxo-6-phenylhex-3-en-3-yl]-3-methylphenoxy]acetate |
| SMILES | CC/C(CCc1ccccc1)=C(\C(=O)C(N)=O)c1c(C)cccc1OCC(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C29H36N2O6/c1-3-23(13-12-22-9-5-4-6-10-22)27(28(33)29(30)34)26-21(2)8-7-11-24(26)37-20-25(32)36-19-16-31-14-17-35-18-15-31/h4-11H,3,12-20H2,1-2H3,(H2,30,34)/b27-23+ |
| InChIKey | YLZHCIRJJJJSNR-SLEBQGDGSA-N |
| XLogP | 3.10 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|