C23H22N4O8 — CID 58895958
3-[[2-(1-benzyl-2-methyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl)oxyacetyl]amino]-3-formyloxypropanoic acid (PubChem CID 58895958) has the molecular formula C23H22N4O8 and a molecular weight of 482.45 g/mol. Its IUPAC name is 3-[[2-(1-benzyl-2-methyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl)oxyacetyl]amino]-3-formyloxypropanoic acid.
| Compound Name | 3-[[2-(1-benzyl-2-methyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl)oxyacetyl]amino]-3-formyloxypropanoic acid |
|---|---|
| PubChem CID | 58895958 |
| Molecular Formula | C23H22N4O8 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 3-[[2-(1-benzyl-2-methyl-3-oxamoylpyrrolo[3,2-c]pyridin-4-yl)oxyacetyl]amino]-3-formyloxypropanoic acid |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)NC(CC(=O)O)OC=O)nccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H22N4O8/c1-13-19(21(32)22(24)33)20-15(27(13)10-14-5-3-2-4-6-14)7-8-25-23(20)34-11-16(29)26-17(35-12-28)9-18(30)31/h2-8,12,17H,9-11H2,1H3,(H2,24,33)(H,26,29)(H,30,31) |
| InChIKey | VNNCGWQSVXFQIN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 179.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|