C27H26N2O5 — CID 71193809
2-[2,9-dimethyl-3-oxamoyl-1-[(2-phenylphenyl)methyl]azonin-5-yl]oxyacetic acid (PubChem CID 71193809) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-[2,9-dimethyl-3-oxamoyl-1-[(2-phenylphenyl)methyl]azonin-5-yl]oxyacetic acid.
| Compound Name | 2-[2,9-dimethyl-3-oxamoyl-1-[(2-phenylphenyl)methyl]azonin-5-yl]oxyacetic acid |
|---|---|
| PubChem CID | 71193809 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-[2,9-dimethyl-3-oxamoyl-1-[(2-phenylphenyl)methyl]azonin-5-yl]oxyacetic acid |
| SMILES | Cc1cccc(OCC(=O)O)cc(C(=O)C(N)=O)c(C)n1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H26N2O5/c1-18-9-8-13-22(34-17-25(30)31)15-24(26(32)27(28)33)19(2)29(18)16-21-12-6-7-14-23(21)20-10-4-3-5-11-20/h3-15H,16-17H2,1-2H3,(H2,28,33)(H,30,31)/b13-8-,18-9-,22-15+,24-19+ |
| InChIKey | SDIPDKYXPBEXQH-FLEUUKSKSA-N |
| XLogP | 4.08 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|