C23H17F3N2O4 — CID 90986809
[5-carbamoyl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] 2-hydroxyacetate (PubChem CID 90986809) has the molecular formula C23H17F3N2O4 and a molecular weight of 442.39 g/mol. Its IUPAC name is [5-carbamoyl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] 2-hydroxyacetate.
| Compound Name | [5-carbamoyl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 90986809 |
| Molecular Formula | C23H17F3N2O4 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [5-carbamoyl-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] 2-hydroxyacetate |
| SMILES | NC(=O)c1cccc2c1c1c(OC(=O)CO)cccc1n2Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H17F3N2O4/c24-23(25,26)15-7-2-1-5-13(15)11-28-16-8-3-6-14(22(27)31)20(16)21-17(28)9-4-10-18(21)32-19(30)12-29/h1-10,29H,11-12H2,(H2,27,31) |
| InChIKey | GYTDMDKXDJYWLZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|