C28H19ClF3NO4 — CID 150949435
[7-(4-chlorophenyl)-5-hydroxy-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] methyl carbonate (PubChem CID 150949435) has the molecular formula C28H19ClF3NO4 and a molecular weight of 525.91 g/mol. Its IUPAC name is [7-(4-chlorophenyl)-5-hydroxy-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] methyl carbonate.
| Compound Name | [7-(4-chlorophenyl)-5-hydroxy-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 150949435 |
| Molecular Formula | C28H19ClF3NO4 |
| Molecular Weight | 525.91 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | [7-(4-chlorophenyl)-5-hydroxy-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl] methyl carbonate |
| SMILES | COC(=O)Oc1cccc2c1c1c(O)cc(-c3ccc(Cl)cc3)cc1n2Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H19ClF3NO4/c1-36-27(35)37-24-8-4-7-21-26(24)25-22(13-18(14-23(25)34)16-9-11-19(29)12-10-16)33(21)15-17-5-2-3-6-20(17)28(30,31)32/h2-14,34H,15H2,1H3 |
| InChIKey | LJTVTLORIVLLIF-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.91 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|