C29H25NO4 — CID 22739554
methyl 7-ethyl-5-hydroxy-9-[(2-phenoxyphenyl)methyl]carbazole-4-carboxylate (PubChem CID 22739554) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl 7-ethyl-5-hydroxy-9-[(2-phenoxyphenyl)methyl]carbazole-4-carboxylate.
| Compound Name | methyl 7-ethyl-5-hydroxy-9-[(2-phenoxyphenyl)methyl]carbazole-4-carboxylate |
|---|---|
| PubChem CID | 22739554 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | methyl 7-ethyl-5-hydroxy-9-[(2-phenoxyphenyl)methyl]carbazole-4-carboxylate |
| SMILES | CCc1cc(O)c2c3c(C(=O)OC)cccc3n(Cc3ccccc3Oc3ccccc3)c2c1 |
| InChI | InChI=1S/C29H25NO4/c1-3-19-16-24-28(25(31)17-19)27-22(29(32)33-2)13-9-14-23(27)30(24)18-20-10-7-8-15-26(20)34-21-11-5-4-6-12-21/h4-17,31H,3,18H2,1-2H3 |
| InChIKey | XKTXDOLCNYICQT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |