C26H26BrNO3 — CID 22740421
methyl 9-[(3-bromophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxylate (PubChem CID 22740421) has the molecular formula C26H26BrNO3 and a molecular weight of 480.40 g/mol. Its IUPAC name is methyl 9-[(3-bromophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxylate.
| Compound Name | methyl 9-[(3-bromophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxylate |
|---|---|
| PubChem CID | 22740421 |
| Molecular Formula | C26H26BrNO3 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | methyl 9-[(3-bromophenyl)methyl]-5-hydroxy-7-pentylcarbazole-4-carboxylate |
| SMILES | CCCCCc1cc(O)c2c3c(C(=O)OC)cccc3n(Cc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C26H26BrNO3/c1-3-4-5-8-17-14-22-25(23(29)15-17)24-20(26(30)31-2)11-7-12-21(24)28(22)16-18-9-6-10-19(27)13-18/h6-7,9-15,29H,3-5,8,16H2,1-2H3 |
| InChIKey | SGGFVLQZMNAKMP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|