C25H25NO3 — CID 142148686
methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate (PubChem CID 142148686) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate.
| Compound Name | methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate |
|---|---|
| PubChem CID | 142148686 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate |
| SMILES | CCc1cc2c(c(O)c1CC)c1c(C(=O)OC)cccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c1-4-17-14-21-23(24(27)18(17)5-2)22-19(25(28)29-3)12-9-13-20(22)26(21)15-16-10-7-6-8-11-16/h6-14,27H,4-5,15H2,1-3H3 |
| InChIKey | GDUDZDREALUZJV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |