About methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate
methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate (PubChem CID 142148686) has the molecular formula C25H25NO3
and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate |
| PubChem CID | 142148686 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate |
| SMILES | CCc1cc2c(c(O)c1CC)c1c(C(=O)OC)cccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c1-4-17-14-21-23(24(27)18(17)5-2)22-19(25(28)29-3)12-9-13-20(22)26(21)15-16-10-7-6-8-11-16/h6-14,27H,4-5,15H2,1-3H3 |
| InChIKey | GDUDZDREALUZJV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate?
The IUPAC name of methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate (CID 142148686) is methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate.
What is the SMILES notation for methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate?
The canonical SMILES for methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate is CCc1cc2c(c(O)c1CC)c1c(C(=O)OC)cccc1n2Cc1ccccc1.
What is the InChIKey of methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate?
The InChIKey is GDUDZDREALUZJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO3/c1-4-17-14-21-23(24(27)18(17)5-2)22-19(25(28)29-3)12-9-13-20(22)26(21)15-16-10-7-6-8-11-16/h6-14,27H,4-5,15H2,1-3H3.
What are the key properties of methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate?
methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate has a molecular weight of 387.48 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-benzyl-6,7-diethyl-5-hydroxycarbazole-4-carboxylate is sourced from PubChem (CID 142148686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).