C21H18N2O3S — CID 174401073
9-[(4-methylsulfonylphenyl)methyl]carbazole-4-carboxamide (PubChem CID 174401073) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 9-[(4-methylsulfonylphenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 9-[(4-methylsulfonylphenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174401073 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 9-[(4-methylsulfonylphenyl)methyl]carbazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Cn2c3ccccc3c3c(C(N)=O)cccc32)cc1 |
| InChI | InChI=1S/C21H18N2O3S/c1-27(25,26)15-11-9-14(10-12-15)13-23-18-7-3-2-5-16(18)20-17(21(22)24)6-4-8-19(20)23/h2-12H,13H2,1H3,(H2,22,24) |
| InChIKey | BCSARGHOAFLUOB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |