C26H17BrCl2N2O — CID 174400340
9-[(2-bromophenyl)methyl]-7-(2,4-dichlorophenyl)carbazole-4-carboxamide (PubChem CID 174400340) has the molecular formula C26H17BrCl2N2O and a molecular weight of 524.25 g/mol. Its IUPAC name is 9-[(2-bromophenyl)methyl]-7-(2,4-dichlorophenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(2-bromophenyl)methyl]-7-(2,4-dichlorophenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174400340 |
| Molecular Formula | C26H17BrCl2N2O |
| Molecular Weight | 524.25 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | 9-[(2-bromophenyl)methyl]-7-(2,4-dichlorophenyl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3ccc(Cl)cc3Cl)cc1n2Cc1ccccc1Br |
| InChI | InChI=1S/C26H17BrCl2N2O/c27-21-6-2-1-4-16(21)14-31-23-7-3-5-20(26(30)32)25(23)19-10-8-15(12-24(19)31)18-11-9-17(28)13-22(18)29/h1-13H,14H2,(H2,30,32) |
| InChIKey | OBALHSSHACPPKO-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.25 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |