C20H14ClIN2O — CID 174414775
7-chloro-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide (PubChem CID 174414775) has the molecular formula C20H14ClIN2O and a molecular weight of 460.70 g/mol. Its IUPAC name is 7-chloro-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-chloro-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414775 |
| Molecular Formula | C20H14ClIN2O |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 7-chloro-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(Cl)cc1n2Cc1ccccc1I |
| InChI | InChI=1S/C20H14ClIN2O/c21-13-8-9-14-18(10-13)24(11-12-4-1-2-6-16(12)22)17-7-3-5-15(19(14)17)20(23)25/h1-10H,11H2,(H2,23,25) |
| InChIKey | PUOGZFGRPWUGDI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|