C27H21ClN2O3S — CID 174418464
7-(4-chlorophenyl)-9-[(2-methylsulfonylphenyl)methyl]carbazole-4-carboxamide (PubChem CID 174418464) has the molecular formula C27H21ClN2O3S and a molecular weight of 489.00 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-9-[(2-methylsulfonylphenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-(4-chlorophenyl)-9-[(2-methylsulfonylphenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174418464 |
| Molecular Formula | C27H21ClN2O3S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 7-(4-chlorophenyl)-9-[(2-methylsulfonylphenyl)methyl]carbazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccccc1Cn1c2cc(-c3ccc(Cl)cc3)ccc2c2c(C(N)=O)cccc21 |
| InChI | InChI=1S/C27H21ClN2O3S/c1-34(32,33)25-8-3-2-5-19(25)16-30-23-7-4-6-22(27(29)31)26(23)21-14-11-18(15-24(21)30)17-9-12-20(28)13-10-17/h2-15H,16H2,1H3,(H2,29,31) |
| InChIKey | PDKRGBNFVLBSLN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |