C28H22ClN3O2 — CID 174401014
9-[(3-acetamidophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide (PubChem CID 174401014) has the molecular formula C28H22ClN3O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is 9-[(3-acetamidophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(3-acetamidophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174401014 |
| Molecular Formula | C28H22ClN3O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 9-[(3-acetamidophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(Cn2c3cc(-c4ccc(Cl)cc4)ccc3c3c(C(N)=O)cccc32)c1 |
| InChI | InChI=1S/C28H22ClN3O2/c1-17(33)31-22-5-2-4-18(14-22)16-32-25-7-3-6-24(28(30)34)27(25)23-13-10-20(15-26(23)32)19-8-11-21(29)12-9-19/h2-15H,16H2,1H3,(H2,30,34)(H,31,33) |
| InChIKey | QMFSZTXMYNAMBY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |