C23H21N3O2 — CID 174414730
9-[(3-acetamidophenyl)methyl]-7-methylcarbazole-4-carboxamide (PubChem CID 174414730) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 9-[(3-acetamidophenyl)methyl]-7-methylcarbazole-4-carboxamide.
| Compound Name | 9-[(3-acetamidophenyl)methyl]-7-methylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414730 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 9-[(3-acetamidophenyl)methyl]-7-methylcarbazole-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(Cn2c3cc(C)ccc3c3c(C(N)=O)cccc32)c1 |
| InChI | InChI=1S/C23H21N3O2/c1-14-9-10-18-21(11-14)26(20-8-4-7-19(22(18)20)23(24)28)13-16-5-3-6-17(12-16)25-15(2)27/h3-12H,13H2,1-2H3,(H2,24,28)(H,25,27) |
| InChIKey | FLPMGBOJAFDSCI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |