C25H19FN2O — CID 174444285
7-fluoro-9-[(6-methylnaphthalen-2-yl)methyl]carbazole-4-carboxamide (PubChem CID 174444285) has the molecular formula C25H19FN2O and a molecular weight of 382.44 g/mol. Its IUPAC name is 7-fluoro-9-[(6-methylnaphthalen-2-yl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-fluoro-9-[(6-methylnaphthalen-2-yl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174444285 |
| Molecular Formula | C25H19FN2O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 7-fluoro-9-[(6-methylnaphthalen-2-yl)methyl]carbazole-4-carboxamide |
| SMILES | Cc1ccc2cc(Cn3c4cc(F)ccc4c4c(C(N)=O)cccc43)ccc2c1 |
| InChI | InChI=1S/C25H19FN2O/c1-15-5-7-18-12-16(6-8-17(18)11-15)14-28-22-4-2-3-21(25(27)29)24(22)20-10-9-19(26)13-23(20)28/h2-13H,14H2,1H3,(H2,27,29) |
| InChIKey | RHGLRROFFKSUDY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |