C28H21Cl2N3O2 — CID 174414749
9-[(4-acetamidophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide (PubChem CID 174414749) has the molecular formula C28H21Cl2N3O2 and a molecular weight of 502.40 g/mol. Its IUPAC name is 9-[(4-acetamidophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(4-acetamidophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414749 |
| Molecular Formula | C28H21Cl2N3O2 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 9-[(4-acetamidophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(Cn2c3cc(-c4c(Cl)cccc4Cl)ccc3c3c(C(N)=O)cccc32)cc1 |
| InChI | InChI=1S/C28H21Cl2N3O2/c1-16(34)32-19-11-8-17(9-12-19)15-33-24-7-2-4-21(28(31)35)27(24)20-13-10-18(14-25(20)33)26-22(29)5-3-6-23(26)30/h2-14H,15H2,1H3,(H2,31,35)(H,32,34) |
| InChIKey | GFWKIKTUTZWBFW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |