C27H17Cl2N3O — CID 174414740
9-[(3-cyanophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide (PubChem CID 174414740) has the molecular formula C27H17Cl2N3O and a molecular weight of 470.36 g/mol. Its IUPAC name is 9-[(3-cyanophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(3-cyanophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414740 |
| Molecular Formula | C27H17Cl2N3O |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 9-[(3-cyanophenyl)methyl]-7-(2,6-dichlorophenyl)carbazole-4-carboxamide |
| SMILES | N#Cc1cccc(Cn2c3cc(-c4c(Cl)cccc4Cl)ccc3c3c(C(N)=O)cccc32)c1 |
| InChI | InChI=1S/C27H17Cl2N3O/c28-21-7-3-8-22(29)25(21)18-10-11-19-24(13-18)32(15-17-5-1-4-16(12-17)14-30)23-9-2-6-20(26(19)23)27(31)33/h1-13H,15H2,(H2,31,33) |
| InChIKey | FNFDNGRCKKHLEK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |