C26H17Cl2IN2O — CID 174440765
7-(2,6-dichlorophenyl)-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide (PubChem CID 174440765) has the molecular formula C26H17Cl2IN2O and a molecular weight of 571.25 g/mol. Its IUPAC name is 7-(2,6-dichlorophenyl)-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-(2,6-dichlorophenyl)-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174440765 |
| Molecular Formula | C26H17Cl2IN2O |
| Molecular Weight | 571.25 g/mol |
| Exact Mass | 569.98 |
| IUPAC Name | 7-(2,6-dichlorophenyl)-9-[(2-iodophenyl)methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3c(Cl)cccc3Cl)cc1n2Cc1ccccc1I |
| InChI | InChI=1S/C26H17Cl2IN2O/c27-19-7-4-8-20(28)24(19)15-11-12-17-23(13-15)31(14-16-5-1-2-9-21(16)29)22-10-3-6-18(25(17)22)26(30)32/h1-13H,14H2,(H2,30,32) |
| InChIKey | ORZLNWQPRXAWTD-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.25 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|