C26H16ClF3N2O — CID 174414809
7-(4-chlorophenyl)-9-[(2,3,5-trifluorophenyl)methyl]carbazole-4-carboxamide (PubChem CID 174414809) has the molecular formula C26H16ClF3N2O and a molecular weight of 464.87 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-9-[(2,3,5-trifluorophenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-(4-chlorophenyl)-9-[(2,3,5-trifluorophenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414809 |
| Molecular Formula | C26H16ClF3N2O |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 7-(4-chlorophenyl)-9-[(2,3,5-trifluorophenyl)methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3ccc(Cl)cc3)cc1n2Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C26H16ClF3N2O/c27-17-7-4-14(5-8-17)15-6-9-19-23(11-15)32(13-16-10-18(28)12-21(29)25(16)30)22-3-1-2-20(24(19)22)26(31)33/h1-12H,13H2,(H2,31,33) |
| InChIKey | HIMVLLJAKMNYQC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|