C28H22Cl2N2O2 — CID 174399730
7-(2,4-dichlorophenyl)-9-[(2-ethoxyphenyl)methyl]carbazole-4-carboxamide (PubChem CID 174399730) has the molecular formula C28H22Cl2N2O2 and a molecular weight of 489.40 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-9-[(2-ethoxyphenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-(2,4-dichlorophenyl)-9-[(2-ethoxyphenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174399730 |
| Molecular Formula | C28H22Cl2N2O2 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-9-[(2-ethoxyphenyl)methyl]carbazole-4-carboxamide |
| SMILES | CCOc1ccccc1Cn1c2cc(-c3ccc(Cl)cc3Cl)ccc2c2c(C(N)=O)cccc21 |
| InChI | InChI=1S/C28H22Cl2N2O2/c1-2-34-26-9-4-3-6-18(26)16-32-24-8-5-7-22(28(31)33)27(24)21-12-10-17(14-25(21)32)20-13-11-19(29)15-23(20)30/h3-15H,2,16H2,1H3,(H2,31,33) |
| InChIKey | OUSFVNSGSQKAOZ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |