C28H22Cl2N2O — CID 174417916
7-(2,4-dichlorophenyl)-9-[(2,3-dimethylphenyl)methyl]carbazole-4-carboxamide (PubChem CID 174417916) has the molecular formula C28H22Cl2N2O and a molecular weight of 473.40 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-9-[(2,3-dimethylphenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-(2,4-dichlorophenyl)-9-[(2,3-dimethylphenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174417916 |
| Molecular Formula | C28H22Cl2N2O |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-9-[(2,3-dimethylphenyl)methyl]carbazole-4-carboxamide |
| SMILES | Cc1cccc(Cn2c3cc(-c4ccc(Cl)cc4Cl)ccc3c3c(C(N)=O)cccc32)c1C |
| InChI | InChI=1S/C28H22Cl2N2O/c1-16-5-3-6-19(17(16)2)15-32-25-8-4-7-23(28(31)33)27(25)22-11-9-18(13-26(22)32)21-12-10-20(29)14-24(21)30/h3-14H,15H2,1-2H3,(H2,31,33) |
| InChIKey | HIZIFQFXJZYRFQ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |