C24H16F2N2OS — CID 174399417
9-[(2,6-difluorophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide (PubChem CID 174399417) has the molecular formula C24H16F2N2OS and a molecular weight of 418.47 g/mol. Its IUPAC name is 9-[(2,6-difluorophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide.
| Compound Name | 9-[(2,6-difluorophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174399417 |
| Molecular Formula | C24H16F2N2OS |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 9-[(2,6-difluorophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3cccs3)cc1n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C24H16F2N2OS/c25-18-5-2-6-19(26)17(18)13-28-20-7-1-4-16(24(27)29)23(20)15-10-9-14(12-21(15)28)22-8-3-11-30-22/h1-12H,13H2,(H2,27,29) |
| InChIKey | RXTHWRPVNHCBQQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |