C26H21N3O2S — CID 174399764
9-[(2-acetamidophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide (PubChem CID 174399764) has the molecular formula C26H21N3O2S and a molecular weight of 439.54 g/mol. Its IUPAC name is 9-[(2-acetamidophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide.
| Compound Name | 9-[(2-acetamidophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174399764 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 9-[(2-acetamidophenyl)methyl]-7-thiophen-2-ylcarbazole-4-carboxamide |
| SMILES | CC(=O)Nc1ccccc1Cn1c2cc(-c3cccs3)ccc2c2c(C(N)=O)cccc21 |
| InChI | InChI=1S/C26H21N3O2S/c1-16(30)28-21-8-3-2-6-18(21)15-29-22-9-4-7-20(26(27)31)25(22)19-12-11-17(14-23(19)29)24-10-5-13-32-24/h2-14H,15H2,1H3,(H2,27,31)(H,28,30) |
| InChIKey | HQRQTUMXKWFMPC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |