C27H24N2OS — CID 174423912
7-thiophen-2-yl-9-[(2,4,6-trimethylphenyl)methyl]carbazole-4-carboxamide (PubChem CID 174423912) has the molecular formula C27H24N2OS and a molecular weight of 424.57 g/mol. Its IUPAC name is 7-thiophen-2-yl-9-[(2,4,6-trimethylphenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-thiophen-2-yl-9-[(2,4,6-trimethylphenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174423912 |
| Molecular Formula | C27H24N2OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 7-thiophen-2-yl-9-[(2,4,6-trimethylphenyl)methyl]carbazole-4-carboxamide |
| SMILES | Cc1cc(C)c(Cn2c3cc(-c4cccs4)ccc3c3c(C(N)=O)cccc32)c(C)c1 |
| InChI | InChI=1S/C27H24N2OS/c1-16-12-17(2)22(18(3)13-16)15-29-23-7-4-6-21(27(28)30)26(23)20-10-9-19(14-24(20)29)25-8-5-11-31-25/h4-14H,15H2,1-3H3,(H2,28,30) |
| InChIKey | LPXUXVLASSBTAP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |