C23H17N3OS — CID 174414157
9-(pyridin-4-ylmethyl)-7-thiophen-2-ylcarbazole-4-carboxamide (PubChem CID 174414157) has the molecular formula C23H17N3OS and a molecular weight of 383.48 g/mol. Its IUPAC name is 9-(pyridin-4-ylmethyl)-7-thiophen-2-ylcarbazole-4-carboxamide.
| Compound Name | 9-(pyridin-4-ylmethyl)-7-thiophen-2-ylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414157 |
| Molecular Formula | C23H17N3OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 9-(pyridin-4-ylmethyl)-7-thiophen-2-ylcarbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3cccs3)cc1n2Cc1ccncc1 |
| InChI | InChI=1S/C23H17N3OS/c24-23(27)18-3-1-4-19-22(18)17-7-6-16(21-5-2-12-28-21)13-20(17)26(19)14-15-8-10-25-11-9-15/h1-13H,14H2,(H2,24,27) |
| InChIKey | OMOSMHVDYHHOLY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |