C22H16N2OS2 — CID 174414759
7-thiophen-2-yl-9-(thiophen-2-ylmethyl)carbazole-4-carboxamide (PubChem CID 174414759) has the molecular formula C22H16N2OS2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 7-thiophen-2-yl-9-(thiophen-2-ylmethyl)carbazole-4-carboxamide.
| Compound Name | 7-thiophen-2-yl-9-(thiophen-2-ylmethyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414759 |
| Molecular Formula | C22H16N2OS2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 7-thiophen-2-yl-9-(thiophen-2-ylmethyl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3cccs3)cc1n2Cc1cccs1 |
| InChI | InChI=1S/C22H16N2OS2/c23-22(25)17-5-1-6-18-21(17)16-9-8-14(20-7-3-11-27-20)12-19(16)24(18)13-15-4-2-10-26-15/h1-12H,13H2,(H2,23,25) |
| InChIKey | CNSSHRJKOLYDRJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |