C27H19ClN2O2 — CID 174414642
9-[(3-benzoylphenyl)methyl]-8-chlorocarbazole-4-carboxamide (PubChem CID 174414642) has the molecular formula C27H19ClN2O2 and a molecular weight of 438.91 g/mol. Its IUPAC name is 9-[(3-benzoylphenyl)methyl]-8-chlorocarbazole-4-carboxamide.
| Compound Name | 9-[(3-benzoylphenyl)methyl]-8-chlorocarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414642 |
| Molecular Formula | C27H19ClN2O2 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 9-[(3-benzoylphenyl)methyl]-8-chlorocarbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1cccc(Cl)c1n2Cc1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H19ClN2O2/c28-22-13-5-11-20-24-21(27(29)32)12-6-14-23(24)30(25(20)22)16-17-7-4-10-19(15-17)26(31)18-8-2-1-3-9-18/h1-15H,16H2,(H2,29,32) |
| InChIKey | FKEVKLVVNVVVFO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |