C24H21N2NaO4 — CID 21304071
sodium 2-[5-carbamoyl-9-[(3,5-dimethylphenyl)methyl]carbazol-4-yl]oxyacetate (PubChem CID 21304071) has the molecular formula C24H21N2NaO4 and a molecular weight of 424.43 g/mol. Its IUPAC name is sodium 2-[5-carbamoyl-9-[(3,5-dimethylphenyl)methyl]carbazol-4-yl]oxyacetate.
| Compound Name | sodium 2-[5-carbamoyl-9-[(3,5-dimethylphenyl)methyl]carbazol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 21304071 |
| Molecular Formula | C24H21N2NaO4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | sodium 2-[5-carbamoyl-9-[(3,5-dimethylphenyl)methyl]carbazol-4-yl]oxyacetate |
| SMILES | Cc1cc(C)cc(Cn2c3cccc(OCC(=O)[O-])c3c3c(C(N)=O)cccc32)c1.[Na+] |
| InChI | InChI=1S/C24H22N2O4.Na/c1-14-9-15(2)11-16(10-14)12-26-18-6-3-5-17(24(25)29)22(18)23-19(26)7-4-8-20(23)30-13-21(27)28;/h3-11H,12-13H2,1-2H3,(H2,25,29)(H,27,28);/q;+1/p-1 |
| InChIKey | GJAWIYGVMPTMGB-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |