C21H30N2O2 — CID 91519432
ethane;5-ethoxy-9-ethylcarbazole-4-carboxamide (PubChem CID 91519432) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is ethane;5-ethoxy-9-ethylcarbazole-4-carboxamide.
| Compound Name | ethane;5-ethoxy-9-ethylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 91519432 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | ethane;5-ethoxy-9-ethylcarbazole-4-carboxamide |
| SMILES | CC.CC.CCOc1cccc2c1c1c(C(N)=O)cccc1n2CC |
| InChI | InChI=1S/C17H18N2O2.2C2H6/c1-3-19-12-8-5-7-11(17(18)20)15(12)16-13(19)9-6-10-14(16)21-4-2;2*1-2/h5-10H,3-4H2,1-2H3,(H2,18,20);2*1-2H3 |
| InChIKey | LFYDDCWXCCLHRZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |