C25H26N2O — CID 174401035
9-[(3,5-dimethylphenyl)methyl]-7-propan-2-ylcarbazole-4-carboxamide (PubChem CID 174401035) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 9-[(3,5-dimethylphenyl)methyl]-7-propan-2-ylcarbazole-4-carboxamide.
| Compound Name | 9-[(3,5-dimethylphenyl)methyl]-7-propan-2-ylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174401035 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 9-[(3,5-dimethylphenyl)methyl]-7-propan-2-ylcarbazole-4-carboxamide |
| SMILES | Cc1cc(C)cc(Cn2c3cc(C(C)C)ccc3c3c(C(N)=O)cccc32)c1 |
| InChI | InChI=1S/C25H26N2O/c1-15(2)19-8-9-20-23(13-19)27(14-18-11-16(3)10-17(4)12-18)22-7-5-6-21(24(20)22)25(26)28/h5-13,15H,14H2,1-4H3,(H2,26,28) |
| InChIKey | HDOGQVNRYJQKHR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |