C19H15N3O2 — CID 22740539
5-hydroxy-9-(pyridin-2-ylmethyl)carbazole-4-carboxamide (PubChem CID 22740539) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-hydroxy-9-(pyridin-2-ylmethyl)carbazole-4-carboxamide.
| Compound Name | 5-hydroxy-9-(pyridin-2-ylmethyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 22740539 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-hydroxy-9-(pyridin-2-ylmethyl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1c(O)cccc1n2Cc1ccccn1 |
| InChI | InChI=1S/C19H15N3O2/c20-19(24)13-6-3-7-14-17(13)18-15(8-4-9-16(18)23)22(14)11-12-5-1-2-10-21-12/h1-10,23H,11H2,(H2,20,24) |
| InChIKey | UTSPAMRUMDHOIX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |